|
CAS#: 99-22-9 Product: Dibenzyl dithiocarbamate No suppilers available for the product. |
| Name | Dibenzyl dithiocarbamate |
|---|---|
| Synonyms | Sodium (Bis(Benzyl)Amino)Methanedithioate; Aids-013410; Aids013410 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14NNaS2 |
| Molecular Weight | 295.39 |
| CAS Registry Number | 99-22-9 (55310-46-8) |
| SMILES | C1=CC=CC=C1CN(C(=S)[S-])CC2=CC=CC=C2.[Na+] |
| InChI | 1S/C15H15NS2.Na/c17-15(18)16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H,17,18);/q;+1/p-1 |
| InChIKey | MYCPTMLDBVIIES-UHFFFAOYSA-M |
| Boiling point | 408.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 200.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzyl dithiocarbamate |