Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Chloro-6-fluoro-3-nitroquinoline |
|---|---|
| Synonyms | 4-Chloro-6-fluoro-3-nitro-quinoline |
| Molecular Structure |  |
| Molecular Formula | C9H4ClFN2O2 |
| Molecular Weight | 226.59 |
| CAS Registry Number | 99010-07-8 |
| SMILES | [O-][N+](=O)c1c(Cl)c2cc(F)ccc2nc1 |
| InChI | 1S/C9H4ClFN2O2/c10-9-6-3-5(11)1-2-7(6)12-4-8(9)13(14)15/h1-4H |
| InChIKey | JTKXABQYVUAKJV-UHFFFAOYSA-N |
| Density | 1.565g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.318°C at 760 mmHg (Cal.) |
| Flash point | 157.805°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-6-fluoro-3-nitroquinoline |