Online Database of Chemicals from Around the World
|
CAS#: 99103-20-5 Product: Dihydrodecaprenyl Phosphate No suppilers available for the product. |
| Name | Dihydrodecaprenyl Phosphate |
|---|---|
| Synonyms | 6,10,14,18,22,26,30,34,38-Tetracontanonaen-1-Ol, 3,7,11,15,19,23,27,31,35,39-Decamethyl-, Dihydrogen Phosphate; N 3554S; N-1554 |
| Molecular Structure |  |
| Molecular Formula | C50H85O4P |
| Molecular Weight | 781.19 |
| CAS Registry Number | 99103-20-5 |
| SMILES | C(O[P](=O)(O)O)CC(CC/C=C(/CC\C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)C)C)C)C)C)C)C |
| InChI | 1S/C50H85O4P/c1-41(2)21-12-22-42(3)23-13-24-43(4)25-14-26-44(5)27-15-28-45(6)29-16-30-46(7)31-17-32-47(8)33-18-34-48(9)35-19-36-49(10)37-20-38-50(11)39-40-54-55(51,52)53/h21,23,25,27,29,31,33,35,37,50H,12-20,22,24,26,28,30,32,34,36,38-40H2,1-11H3,(H2,51,5 |
| InChIKey | TWFMTRIXHOWEDT-ZRBDNFHOSA-N |
| Density | 0.952g/cm3 (Cal.) |
|---|---|
| Boiling point | 795.574°C at 760 mmHg (Cal.) |
| Flash point | 434.948°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydrodecaprenyl Phosphate |