| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Research Organics Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 321-0570 / (216) 883-8025 | |||
![]() |
info@resorg.com, | |||
| Chemical manufacturer | ||||
| Name | L-Alanyl-L-valine |
|---|---|
| Synonyms | (S)-2-((S)-2-aminopropanamido)-3-methylbutanoic acid; (S)-2-((S)-2-Amino-propionylamino)-3-methyl-butyric acid; 2-(2-Amino-propionylamino)-3-methyl-butyric acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.22 |
| CAS Registry Number | 99146-59-5 |
| SMILES | C[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)N |
| InChI | 1S/C8H16N2O3/c1-4(2)6(8(12)13)10-7(11)5(3)9/h4-6H,9H2,1-3H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | LIWMQSWFLXEGMA-WDSKDSINSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.8±30.0°C at 760 mmHg (Cal.) |
| Flash point | 196.8±24.6°C (Cal.) |
| (1) | Angiolina Comotti, Silvia Bracco, Gaetano Distefano and Piero Sozzani. Methane, carbon dioxide and hydrogen storage in nanoporous dipeptide-based materials, Chem. Commun., 2009, 284. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for L-Alanyl-L-valine |