Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Acetyl-2-phenylserine |
|---|---|
| Synonyms | 2-acetamido-3-hydroxy-2-phenylpropanoic acid |
| Molecular Structure |  |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 99155-34-7 |
| SMILES | OC(=O)C(NC(C)=O)(CO)c1ccccc1 |
| InChI | 1S/C11H13NO4/c1-8(14)12-11(7-13,10(15)16)9-5-3-2-4-6-9/h2-6,13H,7H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | BSJDBSMWDFGGJA-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.14°C at 760 mmHg (Cal.) |
| Flash point | 261.718°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-2-phenylserine |