Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | Methyl (2E,4S)-4-amino-5-phenyl-2-pentenoate |
|---|---|
| Synonyms | 2-enoic acid methyl ester; 4-Amino-5-phenyl-pent- |
| Molecular Structure |  |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25 |
| CAS Registry Number | 99281-72-8 |
| SMILES | N[C@@H](Cc1ccccc1)/C=C/C(=O)OC |
| InChI | 1S/C12H15NO2/c1-15-12(14)8-7-11(13)9-10-5-3-2-4-6-10/h2-8,11H,9,13H2,1H3/b8-7+/t11-/m1/s1 |
| InChIKey | GIBLLUQATZGTAM-WSKFYRRCSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.32°C at 760 mmHg (Cal.) |
| Flash point | 182.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E,4S)-4-amino-5-phenyl-2-pentenoate |