|
CAS#: 993-86-2 Product: Diethyl 1-hydroxy-2,2,2-trichloroethylphosphonate No suppilers available for the product. |
| Name | Diethyl 1-hydroxy-2,2,2-trichloroethylphosphonate |
|---|---|
| Synonyms | 2,2,2-Trichloro-1-Diethoxyphosphoryl-Ethanol; Ai3-17763; 1-Hydroxy-2,2,2-Trichloroethyl Diethyl Phosphonite |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12Cl3O4P |
| Molecular Weight | 285.49 |
| CAS Registry Number | 993-86-2 |
| SMILES | C(O[P](C(C(Cl)(Cl)Cl)O)(=O)OCC)C |
| InChI | 1S/C6H12Cl3O4P/c1-3-12-14(11,13-4-2)5(10)6(7,8)9/h5,10H,3-4H2,1-2H3 |
| InChIKey | FGQNUVIUWZJVCR-UHFFFAOYSA-N |
| Density | 1.453g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.936°C at 760 mmHg (Cal.) |
| Flash point | 137.011°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 1-hydroxy-2,2,2-trichloroethylphosphonate |