Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Chloro-2-phenylcyclopropanecarbonyl chloride |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.08 |
| CAS Registry Number | 99360-73-3 |
| SMILES | C1C(C1(C2=CC=CC=C2)Cl)C(=O)Cl |
| InChI | 1S/C10H8Cl2O/c11-9(13)8-6-10(8,12)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | AIOUFHXEIIBQRA-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.4±40.0°C at 760 mmHg (Cal.) |
| Flash point | 117.1±27.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-2-phenylcyclopropanecarbonyl chloride |