Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2,4-Dichlorophenyl)-2-fluoro-2-(1H-imidazol-1-yl)ethanone |
|---|---|
| Synonyms | 1-(2,4-dichlorophenyl)-2-fluoro-2-(1H-imidazol-1-yl)ethanone |
| Molecular Structure |  |
| Molecular Formula | C11H7Cl2FN2O |
| Molecular Weight | 273.09 |
| CAS Registry Number | 99427-96-0 |
| SMILES | O=C(C(F)n1ccnc1)c2ccc(Cl)cc2Cl |
| InChI | 1S/C11H7Cl2FN2O/c12-7-1-2-8(9(13)5-7)10(17)11(14)16-4-3-15-6-16/h1-6,11H |
| InChIKey | YDDALEOLKBROMX-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.528°C at 760 mmHg (Cal.) |
| Flash point | 214.781°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dichlorophenyl)-2-fluoro-2-(1H-imidazol-1-yl)ethanone |