|
CAS#: 99448-81-4 Product: 1-Benzyl-5-nitro-1H-indole-2,3-dione No suppilers available for the product. |
| Name | 1-Benzyl-5-nitro-1H-indole-2,3-dione |
|---|---|
| Synonyms | 1-Benzyl-5-nitro-1H-indole-2,3-dione; 5-NITRO-1-(PHENYLMETHYL)-ISATIN |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25 |
| CAS Registry Number | 99448-81-4 |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)[N+](=O)[O-])C(=O)C2=O |
| InChI | 1S/C15H10N2O4/c18-14-12-8-11(17(20)21)6-7-13(12)16(15(14)19)9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | KRWGZAGTABTYNO-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.8±55.0°C at 760 mmHg (Cal.) |
| Flash point | 253.6±31.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-5-nitro-1H-indole-2,3-dione |