Online Database of Chemicals from Around the World
|
CAS#: 99502-89-3 Product: N-Chlorocarbonyloxy-5-Norborene-2,3-Dicarboximide No suppilers available for the product. |
| Name | N-Chlorocarbonyloxy-5-Norborene-2,3-Dicarboximide |
|---|---|
| Synonyms | Cicoonb; N-Chlorocarbonyloxy-5-Norborene-2,3,-Dicarboximide; 4,7-Methano-1H-Isoindole-1,3(2H)-Dione, 2-((Chlorocarbonyl)Oxy)-3A,4,7,7A-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C10H8ClNO4 |
| Molecular Weight | 241.63 |
| CAS Registry Number | 99502-89-3 |
| SMILES | O=C1N(OC(Cl)=O)C(=O)C2C1C3CC2C=C3 |
| InChI | 1S/C10H8ClNO4/c11-10(15)16-12-8(13)6-4-1-2-5(3-4)7(6)9(12)14/h1-2,4-7H,3H2 |
| InChIKey | WZSYICREJGEVIT-UHFFFAOYSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.509°C at 760 mmHg (Cal.) |
| Flash point | 165.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Chlorocarbonyloxy-5-Norborene-2,3-Dicarboximide |