Online Database of Chemicals from Around the World
|
CAS#: 99529-30-3 Product: 3,7,11,15,18,22,26,30-Octamethyldotriacontane-1,32-Diol No suppilers available for the product. |
| Name | 3,7,11,15,18,22,26,30-Octamethyldotriacontane-1,32-Diol |
|---|---|
| Synonyms | Omdtc; 3,7,11,15,18,22,26,30-Octamethyldotriacontane-1,32-Diol; 3R,7R,11R,15S,18S,22R,26R,30R-Octamethyldotriacontane-1,32-Diol |
| Molecular Structure |  |
| Molecular Formula | C40H82O2 |
| Molecular Weight | 595.09 |
| CAS Registry Number | 99529-30-3 |
| SMILES | [C@H](CCO)(CCC[C@@H](CCC[C@@H](CCC[C@@H](CC[C@H](CCC[C@H](CCC[C@H](CCC[C@H](CCO)C)C)C)C)C)C)C)C |
| InChI | 1S/C40H82O2/c1-33(15-9-17-35(3)21-13-25-39(7)29-31-41)19-11-23-37(5)27-28-38(6)24-12-20-34(2)16-10-18-36(4)22-14-26-40(8)30-32-42/h33-42H,9-32H2,1-8H3/t33-,34-,35+,36+,37-,38-,39+,40+/m0/s1 |
| InChIKey | YIAFMQBFTHBWLC-DZYBFMNNSA-N |
| Density | 0.866g/cm3 (Cal.) |
|---|---|
| Boiling point | 641.519°C at 760 mmHg (Cal.) |
| Flash point | 223.56°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,11,15,18,22,26,30-Octamethyldotriacontane-1,32-Diol |