Online Database of Chemicals from Around the World
|
CAS#: 99624-08-5 Product: 7-Hydroxytrichodermol No suppilers available for the product. |
| Name | 7-Hydroxytrichodermol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 99624-08-5 |
| SMILES | [C@]23(C4(C1(OC1)[C@H](O[C@@H]2C=C(C[C@H]3O)C)C[C@H]4O)C)C |
| InChI | 1S/C15H22O4/c1-8-4-9(16)13(2)11(5-8)19-12-6-10(17)14(13,3)15(12)7-18-15/h5,9-12,16-17H,4,6-7H2,1-3H3/t9-,10-,11-,12-,13+,14?,15?/m1/s1 |
| InChIKey | HSKDIWXLQLBLPQ-HRDJXZGKSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.264°C at 760 mmHg (Cal.) |
| Flash point | 214.621°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxytrichodermol |