| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 5,6-Dihydro-5-Methyl-6-Oxo-4H-Imidazo[1,5-A]Thieno[2,3-F][1,4]Diazepine-3-Carboxylic Acid 1,1-Dimethylethyl Ester |
|---|---|
| Synonyms | C13716; Ro19-4603; Pdsp1_001769 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.38 |
| CAS Registry Number | 99632-94-7 |
| SMILES | C1=NC(=C2CN(C)C(C3=C([N]12)C=CS3)=O)C(=O)OC(C)(C)C |
| InChI | 1S/C15H17N3O3S/c1-15(2,3)21-14(20)11-10-7-17(4)13(19)12-9(5-6-22-12)18(10)8-16-11/h5-6,8H,7H2,1-4H3 |
| InChIKey | ZIGMMUKDYCABPW-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.677°C at 760 mmHg (Cal.) |
| Flash point | 278.977°C (Cal.) |
| solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dihydro-5-Methyl-6-Oxo-4H-Imidazo[1,5-A]Thieno[2,3-F][1,4]Diazepine-3-Carboxylic Acid 1,1-Dimethylethyl Ester |