Online Database of Chemicals from Around the World
|
CAS#: 99688-02-5 Product: 5,5-Dimethyl-1,2,3-Cyclohexanetrione 1,2-Dioxime 3-Thiosemicarbazone No suppilers available for the product. |
| Name | 5,5-Dimethyl-1,2,3-Cyclohexanetrione 1,2-Dioxime 3-Thiosemicarbazone |
|---|---|
| Synonyms | 5,5-Dimethyl-1,2,3-Cyclohexanetrione 1,2-Dioxime 3-Thiosemicarbazone; Nsc615135; Dcdt |
| Molecular Structure |  |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.31 |
| CAS Registry Number | 99688-02-5 |
| SMILES | CC1(CC(=C(N=O)C(=N/NC(=S)N)\C1)NO)C |
| InChI | 1S/C9H15N5O2S/c1-9(2)3-5(11-12-8(10)17)7(14-16)6(4-9)13-15/h13,15H,3-4H2,1-2H3,(H3,10,12,17)/b11-5- |
| InChIKey | DZNNBAYOTBSLSD-WZUFQYTHSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.207°C at 760 mmHg (Cal.) |
| Flash point | 192.815°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-1,2,3-Cyclohexanetrione 1,2-Dioxime 3-Thiosemicarbazone |