Online Database of Chemicals from Around the World
|
CAS#: 99688-43-4 Product: sodium 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate No suppilers available for the product. |
| Name | sodium 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate |
|---|---|
| Molecular Structure | ![CAS#: 99688-43-4， sodium 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate](/moreStructures/99688-43-4.gif) |
| Molecular Formula | C11H24NaO9P |
| Molecular Weight | 354.27 |
| CAS Registry Number | 99688-43-4 |
| EINECS | 309-009-7 |
| SMILES | [Na+].[O-]P(O)(=O)OCCOCCOCCOCCOCCOC |
| InChI | 1S/C11H25O9P.Na/c1-15-2-3-16-4-5-17-6-7-18-8-9-19-10-11-20-21(12,13)14;/h2-11H2,1H3,(H2,12,13,14);/q;+1/p-1 |
| InChIKey | AQCLCQSSUNCAHX-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for sodium 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate |