|
CAS#: 997-20-6 Product: Lys-Lys-Lys-Lys-OH No suppilers available for the product. |
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | Lys-Lys-Lys-Lys-OH |
| Synonyms | (2S)-6-Amino-2-[[(2S)-6-Amino-2-[[(2S)-6-Amino-2-[[(2S)-2,6-Diamino-1-Oxohexyl]Amino]-1-Oxohexyl]Amino]-1-Oxohexyl]Amino]Hexanoic Acid; L-Lysine, N2-(N2-(N2-L-Lysyl-L-Lysyl)-L-Lysyl)-; Tetralysine |
| Molecular Structure | ![]() |
| Molecular Formula | C24H50N8O5 |
| Molecular Weight | 530.71 |
| CAS Registry Number | 997-20-6 |
| SMILES | [C@@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCCCN)CCCCN)(C(=O)N[C@H](C(=O)O)CCCCN)CCCCN |
| InChI | 1S/C24H50N8O5/c25-13-5-1-9-17(29)21(33)30-18(10-2-6-14-26)22(34)31-19(11-3-7-15-27)23(35)32-20(24(36)37)12-4-8-16-28/h17-20H,1-16,25-29H2,(H,30,33)(H,31,34)(H,32,35)(H,36,37)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | RRBGTUQJDFBWNN-MUGJNUQGSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 901.218°C at 760 mmHg (Cal.) |
| Flash point | 498.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lys-Lys-Lys-Lys-OH |