|
CAS#: 99722-82-4 Product: 2-(2-Chloroethoxy)benzenesulfonyl isocyanate No suppilers available for the product. |
| Classification | Chemical pesticide >> Herbicide >> Sulfonylurea herbicide |
|---|---|
| Name | 2-(2-Chloroethoxy)benzenesulfonyl isocyanate |
| Synonyms | O-(B-ChloroEthoxy)BenzeneSulfonylIsocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClNO4S |
| Molecular Weight | 261.68 |
| CAS Registry Number | 99722-82-4 |
| SMILES | O=C=N\S(=O)(=O)c1ccccc1OCCCl |
| InChI | 1S/C9H8ClNO4S/c10-5-6-15-8-3-1-2-4-9(8)16(13,14)11-7-12/h1-4H,5-6H2 |
| InChIKey | LGUQMNDJBRYRRA-UHFFFAOYSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.266°C at 760 mmHg (Cal.) |
| Flash point | 185.593°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Chloroethoxy)benzenesulfonyl isocyanate |