Online Database of Chemicals from Around the World
|
CAS#: 99745-11-6 Product: [R-(Z)]-5-Isopropyl-8-Methylnona-6,8-Dien-2-One No suppilers available for the product. |
| Name | [R-(Z)]-5-Isopropyl-8-Methylnona-6,8-Dien-2-One |
|---|---|
| Synonyms | (6Z)-5-Isopropyl-8-Methyl-Nona-6,8-Dien-2-One; (6Z)-5-Isopropyl-8-Methylnona-6,8-Dien-2-One; (6Z)-8-Methyl-5-Propan-2-Yl-Nona-6,8-Dien-2-One |
| Molecular Structure | ![CAS#: 99745-11-6， [R-(Z)]-5-Isopropyl-8-Methylnona-6,8-Dien-2-One](/moreStructures/99745-11-6.gif) |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 99745-11-6 |
| EINECS | 309-013-9 |
| SMILES | C(C(C(C)C)\C=C/C(=C)C)CC(=O)C |
| InChI | 1S/C13H22O/c1-10(2)6-8-13(11(3)4)9-7-12(5)14/h6,8,11,13H,1,7,9H2,2-5H3/b8-6- |
| InChIKey | PQDRXUSSKFWCFA-VURMDHGXSA-N |
| Density | 0.847g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.021°C at 760 mmHg (Cal.) |
| Flash point | 96.276°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [R-(Z)]-5-Isopropyl-8-Methylnona-6,8-Dien-2-One |