Online Database of Chemicals from Around the World
|
CAS#: 99803-60-8 Product: 4-Nitrosofenitrothion No suppilers available for the product. |
| Name | 4-Nitrosofenitrothion |
|---|---|
| Synonyms | Dimethoxy-(3-Methyl-4-Nitroso-Phenoxy)-Thioxo-Phosphorane; Dimethoxy-(3-Methyl-4-Nitrosophenoxy)-Thioxophosphorane; Dimethoxy-(3-Methyl-4-Nitroso-Phenoxy)-Sulfanylidene-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C9H12NO4PS |
| Molecular Weight | 261.23 |
| CAS Registry Number | 99803-60-8 |
| SMILES | C1=CC(=C(C=C1O[P](OC)(=S)OC)C)N=O |
| InChI | 1S/C9H12NO4PS/c1-7-6-8(4-5-9(7)10-11)14-15(16,12-2)13-3/h4-6H,1-3H3 |
| InChIKey | CNNSBOXZYDQHTQ-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.353°C at 760 mmHg (Cal.) |
| Flash point | 159.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrosofenitrothion |