|
CAS#: 10021-35-9 Product: 2,3-Dihydro-1,3-Benzoxazine-4H-2-Thione-4-One No suppilers available for the product. |
| Name | 2,3-Dihydro-1,3-Benzoxazine-4H-2-Thione-4-One |
|---|---|
| Synonyms | 2-Thioxo-1,3-Benzoxazin-4-One; 2-Thioxo-2,3-Dihydro-1,3-Benzoxazin-4-One; 2-Thioxo-2,3-Dihydro-4H-1,3-Benzoxazin-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.19 |
| CAS Registry Number | 10021-35-9 |
| SMILES | C1=C2C(=CC=C1)OC(=S)NC2=O |
| InChI | 1S/C8H5NO2S/c10-7-5-3-1-2-4-6(5)11-8(12)9-7/h1-4H,(H,9,10,12) |
| InChIKey | XCNLSOGMJQILRA-UHFFFAOYSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.7°C at 760 mmHg (Cal.) |
| Flash point | 140.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-1,3-Benzoxazine-4H-2-Thione-4-One |