|
CAS#: 100217-74-1 Product: Biphenomycin B No suppilers available for the product. |
| Name | Biphenomycin B |
|---|---|
| Synonyms | Biphenomycin B |
| Molecular Structure | ![]() |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 |
| CAS Registry Number | 100217-74-1 |
| SMILES | [C@H]3(NC(=O)[C@@H](N)CC1=C(O)C=CC(=C1)C2=CC=C(O)C(=C2)C[C@H](NC3=O)C(=O)O)C[C@@H](O)CN |
| InChI | 1S/C23H28N4O7/c24-10-15(28)9-17-22(32)27-18(23(33)34)8-14-6-12(2-4-20(14)30)11-1-3-19(29)13(5-11)7-16(25)21(31)26-17/h1-6,15-18,28-30H,7-10,24-25H2,(H,26,31)(H,27,32)(H,33,34)/t15-,16+,17+,18+/m1/s1 |
| InChIKey | OXLPMCIPYGNLJD-OWSLCNJRSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 953.304°C at 760 mmHg (Cal.) |
| Flash point | 530.339°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Biphenomycin B |