Online Database of Chemicals from Around the World
| Classification | Pharmaceutical intermediate >> Heterocyclic compound >> Thiophene compound |
|---|---|
| Name | 7-(Bromomethyl)-Benzo[b]Thiophene |
| Synonyms | 3-Bromobenzothiophene-2-Carbaldehyde; 3-Bromo-2-Benzothiophenecarboxaldehyde; Fs002038 |
| Molecular Structure | ![CAS#: 10135-00-9, 7-(Bromomethyl)-Benzo[b]Thiophene](/moreStructures/10135-00-9.gif) |
| Molecular Formula | C9H5BrOS |
| Molecular Weight | 241.10 |
| CAS Registry Number | 10135-00-9 |
| SMILES | C2=C1C(=C(SC1=CC=C2)C=O)Br |
| InChI | 1S/C9H5BrOS/c10-9-6-3-1-2-4-7(6)12-8(9)5-11/h1-5H |
| InChIKey | GQUZXULTSUGIRF-UHFFFAOYSA-N |
| Desity | 1.711g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.345°C at 760 mmHg (Cal.) |
| Flash point | 166.288°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-(Bromomethyl)-Benzo[b]Thiophene |