| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | 1,1'-(2-Chloroethenylidene)Bis[4-Chloro-Benzene] |
| Synonyms | 1-Chloro-4-[2-Chloro-1-(4-Chlorophenyl)Vinyl]Benzene; 1,1-Bis(P-Chlorophenyl)-2-Chloroethene; 1,1-Bis(P-Chlorophenyl)-2-Chloroethylene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Cl3 |
| Molecular Weight | 283.58 |
| CAS Registry Number | 1022-22-6 |
| EINECS | 213-823-7 |
| SMILES | C2=C(C(C1=CC=C(Cl)C=C1)=CCl)C=CC(=C2)Cl |
| InChI | 1S/C14H9Cl3/c15-9-14(10-1-5-12(16)6-2-10)11-3-7-13(17)8-4-11/h1-9H |
| InChIKey | LNKQQZFLNUVWQQ-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.498°C at 760 mmHg (Cal.) |
| Flash point | 264.465°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Hisashi Shimakoshi, Mami Tokunaga and Yoshio Hisaeda. Hydrophobic vitamin B. Part 19: Electroorganic reaction of DDT mediated by hydrophobic vitamin B, Dalton Trans., 2004, 0, 878. |
|---|---|
| Market Analysis Reports |