| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Crescent Chemical Co. Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | 1-Chloro-4-[(4-Chlorophenyl)Sulfanylmethyl]Benzene |
| Synonyms | 1-Chloro-4-[[(4-Chlorophenyl)Thio]Methyl]Benzene; Chlorbenxide; (4-Chloor-Benzyl)-(4-Chloor-Fenyl)-Sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Cl2S |
| Molecular Weight | 269.19 |
| CAS Registry Number | 103-17-3 |
| EINECS | 203-084-9 |
| SMILES | C2=C(SCC1=CC=C(Cl)C=C1)C=CC(=C2)Cl |
| InChI | 1S/C13H10Cl2S/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-8H,9H2 |
| InChIKey | ZHLKXBJTJHRTTE-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.207°C at 760 mmHg (Cal.) |
| Flash point | 168.377°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-[(4-Chlorophenyl)Sulfanylmethyl]Benzene |