|
CAS#: 103878-94-0 Product: [4-(2-Aminoethyl)-2-Hydroxyphenyl] Dihydrogen Phosphate No suppilers available for the product. |
| Name | [4-(2-Aminoethyl)-2-Hydroxyphenyl] Dihydrogen Phosphate |
|---|---|
| Synonyms | [4-(2-Aminoethyl)-2-Hydroxy-Phenyl] Dihydrogen Phosphate; Dopamine-4-Phosphate Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12NO5P |
| Molecular Weight | 233.16 |
| CAS Registry Number | 103878-94-0 |
| SMILES | C1=C(O[P](=O)(O)O)C(=CC(=C1)CCN)O |
| InChI | 1S/C8H12NO5P/c9-4-3-6-1-2-8(7(10)5-6)14-15(11,12)13/h1-2,5,10H,3-4,9H2,(H2,11,12,13) |
| InChIKey | LUCQEJOLALDAFW-UHFFFAOYSA-N |
| Density | 1.544g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.1°C at 760 mmHg (Cal.) |
| Flash point | 242.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(2-Aminoethyl)-2-Hydroxyphenyl] Dihydrogen Phosphate |