|
CAS#: 10388-62-2 Product: (19E)-1-acetyl-19,20-didehydro-Curan-17-ol No suppilers available for the product. |
| Name | (19E)-1-acetyl-19,20-didehydro-Curan-17-ol |
|---|---|
| Synonyms | 16-Isoretuline (7CI,8CI); Isoretuline |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.44 |
| CAS Registry Number | 10388-62-2 |
| SMILES | O=C(N2c1c(cccc1)C35[C@@H]2[C@@H]([C@@H]4C(=CC)CN(CC3)[C@H]5C4)CO)C |
| InChI | 1S/C21H26N2O2/c1-3-14-11-22-9-8-21-17-6-4-5-7-18(17)23(13(2)25)20(21)16(12-24)15(14)10-19(21)22/h3-7,15-16,19-20,24H,8-12H2,1-2H3/t15-,16+,19-,20-,21?/m0/s1 |
| InChIKey | IJTKEUDLEABZCZ-CLRGLAINSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.553°C at 760 mmHg (Cal.) |
| Flash point | 292.207°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (19E)-1-acetyl-19,20-didehydro-Curan-17-ol |