|
CAS#: 10430-85-0 Product: 4-Methoxyphenyl Methacrylate No suppilers available for the product. |
| Name | 4-Methoxyphenyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid (4-Methoxyphenyl) Ester; 2-Methylacrylic Acid (4-Methoxyphenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 |
| CAS Registry Number | 10430-85-0 |
| EINECS | 233-908-2 |
| SMILES | C1=C(OC(=O)C(=C)C)C=CC(=C1)OC |
| InChI | 1S/C11H12O3/c1-8(2)11(12)14-10-6-4-9(13-3)5-7-10/h4-7H,1H2,2-3H3 |
| InChIKey | WIZMCLXMWBKNKH-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.723°C at 760 mmHg (Cal.) |
| Flash point | 121.287°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxyphenyl Methacrylate |