| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Advanced Synthesis | USA | |||
|---|---|---|---|---|
![]() |
+1 (619) 423-7821 | |||
![]() |
sales@advancedsynthesis.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aromatic carboxylic acid ester |
|---|---|
| Name | Geranyl Isovalerate |
| Synonyms | 3-Methylbutanoic Acid [(3E)-3,7-Dimethylocta-3,6-Dienyl] Ester; 3-Methylbutyric Acid [(3E)-3,7-Dimethylocta-3,6-Dienyl] Ester; Geranyl Isovalerate |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 109-20-6 |
| EINECS | 203-655-2 |
| FEMA | 2518 |
| SMILES | C(C(OCC\C(=C\CC=C(C)C)C)=O)C(C)C |
| InChI | 1S/C15H26O2/c1-12(2)7-6-8-14(5)9-10-17-15(16)11-13(3)4/h7-8,13H,6,9-11H2,1-5H3/b14-8+ |
| InChIKey | BBEADJUJSGDTDD-RIYZIHGNSA-N |
| Density | 0.893g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.121°C at 760 mmHg (Cal.) |
| Flash point | 97.527°C (Cal.) |
| Market Analysis Reports |