| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 7-Hydroxy-4-(4-Methoxyphenyl)-2-Chromanone |
|---|---|
| Synonyms | 7-hydroxy-4-(4-methoxyphenyl)-3,4-dihydro-2H-chromen-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Registry Number | 109386-28-9 |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)OC3=C2C=CC(=C3)O |
| InChI | 1S/C16H14O4/c1-19-12-5-2-10(3-6-12)14-9-16(18)20-15-8-11(17)4-7-13(14)15/h2-8,14,17H,9H2,1H3 |
| InChIKey | TVTWPOIVJDSMAX-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 162.2±22.2°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| (1) | K. Rajalakshmi, N. Jain, S. Deepthi, H. G. Krishnamurthy and V. Pattabhi. 7-Hydroxy-4-(4-methoxyphenyl)-3,4-dihydrocoumarin, Acta Cryst. (1999). C55, 813-815 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxy-4-(4-Methoxyphenyl)-2-Chromanone |