|
CAS#: 109467-69-8 Product: (3,3-Dimethyl-1-Cyclohexenyl) Diethyl Phosphate No suppilers available for the product. |
| Name | (3,3-Dimethyl-1-Cyclohexenyl) Diethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid (3,3-Dimethyl-1-Cyclohexenyl) Diethyl Ester; Zinc04282656 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23O4P |
| Molecular Weight | 262.29 |
| CAS Registry Number | 109467-69-8 |
| SMILES | C(O[P](OC1=CC(CCC1)(C)C)(=O)OCC)C |
| InChI | 1S/C12H23O4P/c1-5-14-17(13,15-6-2)16-11-8-7-9-12(3,4)10-11/h10H,5-9H2,1-4H3 |
| InChIKey | VVRQVRIMTLVMRN-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.454°C at 760 mmHg (Cal.) |
| Flash point | 145.786°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3,3-Dimethyl-1-Cyclohexenyl) Diethyl Phosphate |