| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S,3R)-3-Hydroxy-2-Piperidinecarboxylic Acid |
|---|---|
| Synonyms | (2S,3R)-3-hydroxypipecolic acid; (2S,3R)-3-hydroxypiperidine-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 |
| CAS Registry Number | 112241-70-0 |
| SMILES | C1C[C@H]([C@H](NC1)C(=O)O)O |
| InChI | 1S/C6H11NO3/c8-4-2-1-3-7-5(4)6(9)10/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | FDMYUQHVJYNDLI-UHNVWZDZSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 168.4±27.9°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| (1) | Sunil V. Pansare and Eldho K. Paul. Synthesis of (+)-L-733,060, (+)-CP-99,994 and (2S,3R)-3-hydroxypipecolic acid: Application of an organocatalytic direct vinylogous aldol reaction, Org. Biomol. Chem., 2012, 10, 2119. |
|---|---|
| Market Analysis Reports |