Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Ethoxy-1-Naphthylamine |
|---|---|
| Synonyms | 2-Ethoxy-1-Naphthalenamine; (2-Ethoxy-1-Naphthyl)Amine; 1-Amino-2-Ethoxynaphthalene |
| Molecular Structure |  |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 118-30-9 |
| EINECS | 204-243-5 |
| SMILES | C1=C(C(=C2C(=C1)C=CC=C2)N)OCC |
| InChI | 1S/C12H13NO/c1-2-14-11-8-7-9-5-3-4-6-10(9)12(11)13/h3-8H,2,13H2,1H3 |
| InChIKey | TUOWYJFPLMIKCX-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.472°C at 760 mmHg (Cal.) |
| Flash point | 169.769°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethoxy-1-Naphthylamine |