| Name | Phenyltellanylbenzene |
|---|---|
| Synonyms | (Phenyltelluro)Benzene; 3-06-00-01123 (Beilstein Handbook Reference); Brn 2043170 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10Te |
| Molecular Weight | 281.81 |
| CAS Registry Number | 1202-36-4 |
| EINECS | 214-865-9 |
| SMILES | C1=CC=CC=C1[Te]C2=CC=CC=C2 |
| InChI | 1S/C12H10Te/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | XTCBHFKSTRGVMZ-UHFFFAOYSA-N |
| (1) | Saad Shabaan, Lalla A. Ba, Muhammad Abbas, Torsten Burkholz, Annika Denkert, André Gohr, Ludger A. Wessjohann, Florenz Sasse, Wolfgang Weber and Claus Jacob. Multicomponent reactions for the synthesis of multifunctional agents with activity against cancer cells, Chem. Commun., 2009, 4702. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phenyltellanylbenzene |