| CAS: 1217732-80-3 Product: Normethyl Fentanyl-d3 Hydrochloride Salt No suppliers available. |
| Classification | Organic raw materials >> Heterocyclic compound >> Piperidines |
|---|---|
| Name | Normethyl Fentanyl-d3 Hydrochloride Salt |
| Synonyms | 3,3,3-trideuterio-N-[(3S,4R)-3-methylpiperidin-4-yl]-N-phenylpropanamide;hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20D3ClN2O |
| Molecular Weight | 285.83 |
| CAS Registry Number | 1217732-80-3 |
| SMILES | [2H]C([2H])([2H])CC(=O)N([C@@H]1CCNC[C@@H]1C)C2=CC=CC=C2.Cl |
|
Normethyl fentanyl-d3 hydrochloride salt is a deuterium-labeled analog of normethyl fentanyl, used primarily as an internal standard in analytical and forensic applications. The structure of this compound incorporates three deuterium atoms (heavy hydrogen, represented as D or 2H) in place of three corresponding hydrogen atoms within the normethyl fentanyl scaffold. This isotopic labeling allows for precise differentiation between the labeled compound and the non-labeled version using mass spectrometric techniques, without significantly altering its chemical behavior or chromatographic retention. References none |
| Market Analysis Reports |