|
CAS#: 125088-75-7 Product: Methyl 3-Amino-4-Methyl-2,5-Dihydro-2-Thiophenecarboxylate 1-Oxide No suppilers available for the product. |
| Name | Methyl 3-Amino-4-Methyl-2,5-Dihydro-2-Thiophenecarboxylate 1-Oxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.23 |
| CAS Registry Number | 125088-75-7 |
| SMILES | CC1=C(C(S(=O)C1)C(=O)OC)N |
| InChI | 1S/C7H11NO3S/c1-4-3-12(10)6(5(4)8)7(9)11-2/h6H,3,8H2,1-2H3 |
| InChIKey | UQVYGOMIXXOFMC-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.765°C at 760 mmHg (Cal.) |
| Flash point | 194.362°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Amino-4-Methyl-2,5-Dihydro-2-Thiophenecarboxylate 1-Oxide |