|
CAS#: 12737-87-0 Product: 3,3',5,5'-Tetrachlorobiphenyl No suppilers available for the product. |
| Name | 3,3',5,5'-Tetrachlorobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 3,3',5,5'-Tetrachloro- (9Ci); 3,3',5,5'-Tetrachlorobiphenyl; 3,3',5,5'-Tetrachlorodiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.99 |
| CAS Registry Number | 12737-87-0 |
| SMILES | C2=C(C1=CC(=CC(=C1)Cl)Cl)C=C(Cl)C=C2Cl |
| InChI | 1S/C12H6Cl4/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8/h1-6H |
| InChIKey | UTMWFJSRHLYRPY-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.922°C at 760 mmHg (Cal.) |
| Flash point | 190.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3',5,5'-Tetrachlorobiphenyl |