Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054//+86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[(3-Methylbutyl)Sulfanyl]Pyridine 1-Oxide |
|---|---|
| Synonyms | 4-(isopentylthio)pyridine 1-oxide |
| Molecular Structure | ![CAS#: 129598-82-9, 4-[(3-Methylbutyl)Sulfanyl]Pyridine 1-Oxide](/moreStructures/129598-82-9.gif) |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 |
| CAS Registry Number | 129598-82-9 |
| SMILES | CC(C)CCSc1cc[n+](cc1)[O-] |
| InChI | 1S/C10H15NOS/c1-9(2)5-8-13-10-3-6-11(12)7-4-10/h3-4,6-7,9H,5,8H2,1-2H3 |
| InChIKey | NTWKDVUSMYCGEV-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.777°C at 760 mmHg (Cal.) |
| Flash point | 176.225°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(3-Methylbutyl)Sulfanyl]Pyridine 1-Oxide |