|
CAS#: 129679-47-6 Product: Dihydro-7-butyl-1,4-Ethano-1H,3H-thieno(3,4-c)thiophene-3,6(4H)-dione No suppilers available for the product. |
| Name | Dihydro-7-butyl-1,4-Ethano-1H,3H-thieno(3,4-c)thiophene-3,6(4H)-dione |
|---|---|
| Synonyms | 1,4-Ethano-1H,3H-Thieno(3,4-C)Thiophene-3,6(4H)-Dione, Dihydro-7-Butyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2S2 |
| Molecular Weight | 256.38 |
| CAS Registry Number | 129679-47-6 |
| SMILES | C(C3C1C2C(C(S1)=O)C(SC2=O)C3)CCC |
| InChI | 1S/C12H16O2S2/c1-2-3-4-6-5-7-8-9(12(14)15-7)10(6)16-11(8)13/h6-10H,2-5H2,1H3 |
| InChIKey | KEWZQDHKSMGBCE-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.876°C at 760 mmHg (Cal.) |
| Flash point | 201.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydro-7-butyl-1,4-Ethano-1H,3H-thieno(3,4-c)thiophene-3,6(4H)-dione |