Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 4,4,4-Trichloro-2-Butenoicacid Ethyl Ester |
|---|---|
| Synonyms | (Z)-4,4,4-Trichlorobut-2-Enoic Acid Ethyl Ester; Nsc53872 |
| Molecular Structure |  |
| Molecular Formula | C6H7Cl3O2 |
| Molecular Weight | 217.48 |
| CAS Registry Number | 13001-71-3 |
| SMILES | C(C)OC(=O)\C=C/C(Cl)(Cl)Cl |
| InChI | 1S/C6H7Cl3O2/c1-2-11-5(10)3-4-6(7,8)9/h3-4H,2H2,1H3/b4-3- |
| InChIKey | IZIBACDHNNVHQA-ARJAWSKDSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 235.145°C at 760 mmHg (Cal.) |
| Flash point | 93.801°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,4-Trichloro-2-Butenoicacid Ethyl Ester |