Online Database of Chemicals from Around the World
|
CAS#: 13181-62-9 Product: N'-(3-Chloro-o-Tolyl)-N,N-Dimethylformamidine No suppilers available for the product. |
| Name | N'-(3-Chloro-o-Tolyl)-N,N-Dimethylformamidine |
|---|---|
| Synonyms | N'-(3-Chloro-2-Methyl-Phenyl)-N,N-Dimethyl-Formamidine; N'-(3-Chloro-2-Methylphenyl)-N,N-Dimethylformamidine; N'-(3-Chloro-2-Methyl-Phenyl)-N,N-Dimethyl-Methanimidamide |
| Molecular Structure |  |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 |
| CAS Registry Number | 13181-62-9 |
| SMILES | C1=CC=C(Cl)C(=C1N=CN(C)C)C |
| InChI | 1S/C10H13ClN2/c1-8-9(11)5-4-6-10(8)12-7-13(2)3/h4-7H,1-3H3 |
| InChIKey | LHINIZHABFWJGI-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.536°C at 760 mmHg (Cal.) |
| Flash point | 132.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-(3-Chloro-o-Tolyl)-N,N-Dimethylformamidine |