|
CAS#: 13443-57-7 Product: 3-O-Methylascorbic Acid No suppilers available for the product. |
| Name | 3-O-Methylascorbic Acid |
|---|---|
| Synonyms | L-Ascorbic Acid, 3-O-Methyl-; 3-O-Methyl-L-Ascorbic Acid; 3-O-Methylascorbic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 |
| CAS Registry Number | 13443-57-7 |
| SMILES | [C@H](C1C(=C(C(O1)=O)O)OC)(O)CO |
| InChI | 1S/C7H10O6/c1-12-6-4(10)7(11)13-5(6)3(9)2-8/h3,5,8-10H,2H2,1H3/t3-,5?/m0/s1 |
| InChIKey | HFSCYDMAVALOIA-WWLRPLJCSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 569.307°C at 760 mmHg (Cal.) |
| Flash point | 240.143°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-O-Methylascorbic Acid |