| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | trans-2-Phenylcyclopropylamine Hemisulfate |
| Synonyms | [(1S,2R)-2-Phenylcyclopropyl]Ammonium Sulfate; Parnate; (+-)-Trans-2-Phenylcyclopropylamine Sulfate (2:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.46 |
| CAS Registry Number | 13492-01-8 |
| EINECS | 236-807-1 |
| SMILES | [C@H]1([C@@H]([NH3+])C1)C2=CC=CC=C2.[C@@H]3([C@H]([NH3+])C3)C4=CC=CC=C4.O=[S]([O-])([O-])=O |
| InChI | 1S/2C9H11N.H2O4S/c2*10-9-6-8(9)7-4-2-1-3-5-7;1-5(2,3)4/h2*1-5,8-9H,6,10H2;(H2,1,2,3,4)/t2*8-,9+;/m10./s1 |
| InChIKey | BKPRVQDIOGQWTG-ICOOEGOYSA-N |
| Boiling point | 218.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 90.8°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for trans-2-Phenylcyclopropylamine Hemisulfate |