|
CAS#: 13560-99-1 Product: Sodium 2,4,5-Trichlorophenoxyacetate No suppilers available for the product. |
| Name | Sodium 2,4,5-Trichlorophenoxyacetate |
|---|---|
| Synonyms | Sodium 2-(2,4,5-Trichlorophenoxy)Ethanoate; 2-(2,4,5-Trichlorophenoxy)Propionic Acid, Sodium Salt; Caswell No. 739O |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl3NaO3 |
| Molecular Weight | 277.47 |
| CAS Registry Number | 13560-99-1 (37913-89-6) |
| EINECS | 236-949-4 |
| SMILES | C1=C(Cl)C(=CC(=C1OCC([O-])=O)Cl)Cl.[Na+] |
| InChI | 1S/C8H5Cl3O3.Na/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;/h1-2H,3H2,(H,12,13);/q;+1/p-1 |
| InChIKey | KXVMKVOQCMSZSZ-UHFFFAOYSA-M |
| Boiling point | 376.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181.4°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Sodium 2,4,5-Trichlorophenoxyacetate |