|
CAS#: 13639-74-2 Product: Methyldiphenylphosphine Sulfide No suppilers available for the product. |
| Name | Methyldiphenylphosphine Sulfide |
|---|---|
| Synonyms | Hydrogen Sulfide; Methyl-Diphenyl-Phosphane; Methyl-Diphenyl-Phosphane; Sulfane; Methyldiphenylphosphine Sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15PS |
| Molecular Weight | 234.30 |
| CAS Registry Number | 13639-74-2 |
| SMILES | P(C1=CC=CC=C1)(C2=CC=CC=C2)C.S |
| InChI | 1S/C13H13P.H2S/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2-11H,1H3;1H2 |
| InChIKey | OMQHFHFMDJQVPA-UHFFFAOYSA-N |
| Boiling point | 308.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 128.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyldiphenylphosphine Sulfide |