Online Database of Chemicals from Around the World
|
CAS#: 13644-08-1 Product: 1-(4-Methylphenoxy)-2,8,9-Trioxa-5-Aza-1-Silabicyclo[3.3.3]Undecane No suppilers available for the product. |
| Name | 1-(4-Methylphenoxy)-2,8,9-Trioxa-5-Aza-1-Silabicyclo[3.3.3]Undecane |
|---|---|
| Synonyms | 1-(P-Methylphenoxy)-Silatrane; 1-(P-Tolyloxy)-2,8,9-Trioxa-5-Aza-1-Silabicyclo(3.3.3)Undecane; 1-(P-Tolyloxy)Silatrane |
| Molecular Structure | ![CAS#: 13644-08-1, 1-(4-Methylphenoxy)-2,8,9-Trioxa-5-Aza-1-Silabicyclo[3.3.3]Undecane](/moreStructures/13644-08-1.gif) |
| Molecular Formula | C13H19NO4Si |
| Molecular Weight | 281.38 |
| CAS Registry Number | 13644-08-1 |
| SMILES | C1=C(C=CC(=C1)C)O[Si]23OCCN(CCO2)CCO3 |
| InChI | 1S/C13H19NO4Si/c1-12-2-4-13(5-3-12)18-19-15-9-6-14(7-10-16-19)8-11-17-19/h2-5H,6-11H2,1H3 |
| InChIKey | JSMJJRXGICSIMK-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.372°C at 760 mmHg (Cal.) |
| Flash point | 157.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methylphenoxy)-2,8,9-Trioxa-5-Aza-1-Silabicyclo[3.3.3]Undecane |