|
CAS#: 136440-26-1 Product: 2-Methyl-2-Nonyl-4-Phenyl-2H-Imidazole 1-Oxide No suppilers available for the product. |
| Name | 2-Methyl-2-Nonyl-4-Phenyl-2H-Imidazole 1-Oxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.44 |
| CAS Registry Number | 136440-26-1 |
| SMILES | CCCCCCCCCC1(N=C(C=[N+]1[O-])c2ccccc2)C |
| InChI | 1S/C19H28N2O/c1-3-4-5-6-7-8-12-15-19(2)20-18(16-21(19)22)17-13-10-9-11-14-17/h9-11,13-14,16H,3-8,12,15H2,1-2H3 |
| InChIKey | OXPFBRNOQXIEFB-UHFFFAOYSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.606°C at 760 mmHg (Cal.) |
| Flash point | 208.175°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Nonyl-4-Phenyl-2H-Imidazole 1-Oxide |