Online Database of Chemicals from Around the World
|
CAS#: 136910-75-3 Product: 2,3-Dihydro-1H-Indol-5-Yl N,N-Dimethylcarbamate No suppilers available for the product. |
| Name | 2,3-Dihydro-1H-Indol-5-Yl N,N-Dimethylcarbamate |
|---|---|
| Synonyms | Indolin-5-Yl N,N-Dimethylcarbamate; N,N-Dimethylcarbamic Acid 5-Indolinyl Ester; N,N-Dimethylcarbamic Acid Indolin-5-Yl Ester |
| Molecular Structure |  |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 136910-75-3 |
| SMILES | C1=C(OC(N(C)C)=O)C=CC2=C1CCN2 |
| InChI | 1S/C11H14N2O2/c1-13(2)11(14)15-9-3-4-10-8(7-9)5-6-12-10/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | SBKCKKGFPVFSFE-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.118°C at 760 mmHg (Cal.) |
| Flash point | 163.126°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-1H-Indol-5-Yl N,N-Dimethylcarbamate |