| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 1'-Benzyl-2,3-Dihydrospiro[Indene-1,4'-Piperidine] (2Z)-2-Butenedioate (1:1) |
|---|---|
| Synonyms | [137730-52-0]; L-693,403 maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 |
| CAS Registry Number | 137730-52-0 |
| SMILES | C1CC2(CCN(CC2)CC3=CC=CC=C3)C4=CC=CC=C41.C(=C\C(=O)O)\C(=O)O |
| InChI | 1S/C20H23N.C4H4O4/c1-2-6-17(7-3-1)16-21-14-12-20(13-15-21)11-10-18-8-4-5-9-19(18)20;5-3(6)1-2-4(7)8/h1-9H,10-16H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WAZQVIBRRAMDNX-BTJKTKAUSA-N |
| Refractive index | (Cal.) |
|---|---|
| solubility | Soluble to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for 1'-Benzyl-2,3-Dihydrospiro[Indene-1,4'-Piperidine] (2Z)-2-Butenedioate (1:1) |