|
CAS#: 140210-44-2 Product: (E)-Methoxy-[(5E)-5-Methoxyimino-2,2,4,4-Tetramethyl-Cyclopentylidene]Amine No suppilers available for the product. |
| Name | (E)-Methoxy-[(5E)-5-Methoxyimino-2,2,4,4-Tetramethyl-Cyclopentylidene]Amine |
|---|---|
| Synonyms | Cyclopentane-1,2-Dione, 3,3,5,5-Tetramethyl, Bis(O-Methyloxime)-(E,E)-; Cyclopentane-1,2-Dione, 3,3,5,5-Tetramethyl-, Bis(O-Methyloxime)-, (E,E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 140210-44-2 |
| SMILES | CC1(C(=N/OC)\C(=N\OC)C(C1)(C)C)C |
| InChI | 1S/C11H20N2O2/c1-10(2)7-11(3,4)9(13-15-6)8(10)12-14-5/h7H2,1-6H3/b12-8-,13-9- |
| InChIKey | RECQGPOZJVAMAO-JMVBYTIWSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.938°C at 760 mmHg (Cal.) |
| Flash point | 84.521°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-Methoxy-[(5E)-5-Methoxyimino-2,2,4,4-Tetramethyl-Cyclopentylidene]Amine |